ChemNet > CAS > 19404-18-3 5-chloro-3-methylbenzo[b]thiophene
19404-18-3 5-chloro-3-methylbenzo[b]thiophene
نام محصول |
5-chloro-3-methylbenzo[b]thiophene |
مترادف |
5-Chloro-3-methylthianaphthene; 5-chloro-3-methyl-1-benzothiophene |
میدان مغناطیسی |
C9H7ClS |
وزن مولکولی |
182.6699 |
InChI |
InChI=1/C9H7ClS/c1-6-5-11-9-3-2-7(10)4-8(6)9/h2-5H,1H3 |
شماره سیایاس |
19404-18-3 |
ساختار مولکولی |
|
تراکم |
1.293g/cm3 |
نقطه ذوب |
32℃ |
نقطه غلیان |
280.5°C at 760 mmHg |
ضریب شکست |
1.66 |
نقطه اشتعال |
163.1°C |
خطر نمادها |
Xi:Irritant;
|
کدهای خطر |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|